|
|
| | W-5 Hydrochloride Basic information |
| | W-5 Hydrochloride Chemical Properties |
| Melting point | 150-152oC | | storage temp. | 0-6°C | | solubility | H2O: soluble15mg/mL, clear | | form | powder or crystals | | color | white to beige | | Water Solubility | H2O: 15mg/mL, clear | | InChI | 1S/C16H22N2O2S.ClH/c17-12-5-1-2-6-13-18-21(19,20)16-11-7-9-14-8-3-4-10-15(14)16;/h3-4,7-11,18H,1-2,5-6,12-13,17H2;1H | | InChIKey | HOCSVIGHWPLMFC-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(NCCCCCCN)c1c2c(ccc1)cccc2.Cl | | CAS DataBase Reference | 61714-25-8 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2935.90.9500 | | Storage Class | 11 - Combustible Solids |
| | W-5 Hydrochloride Usage And Synthesis |
| Chemical Properties | Off-White Crystalline Solid | | Uses | Calmodulin antagonist that binds to calmodulin and inhibits calcium-ion-calmodulin- regulated activities, including phosphodiesterase activation and myosin light chain kinase | | Biological Activity | Calmodulin antagonist (inhibits Ca 2+ -calmodulin dependent PDE with an IC 50 of 240 μ M). | | storage | Room temperature |
| | W-5 Hydrochloride Preparation Products And Raw materials |
|