| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | Ethyl L-alaninate hydrochloride Basic information |
| | Ethyl L-alaninate hydrochloride Chemical Properties |
| Melting point | 78-80 °C (dec.)(lit.) | | alpha | 3.1 º (c=2.5, H2O) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | 100g/l | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]22/D +2.5°, c = 2.5 in H2O | | Sensitive | Hygroscopic | | BRN | 3594395 | | Major Application | peptide synthesis | | InChI | InChI=1/C5H11NO2.ClH/c1-3-8-5(7)4(2)6;/h4H,3,6H2,1-2H3;1H/t4-;/s3 | | InChIKey | JCXLZWMDXJFOOI-NDILARRWNA-N | | SMILES | C(=O)([C@@H](N)C)OCC.Cl |&1:2,r| | | CAS DataBase Reference | 1115-59-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | F | 3-10 | | Hazard Note | Irritant | | HS Code | 29224995 | | Storage Class | 11 - Combustible Solids |
| | Ethyl L-alaninate hydrochloride Usage And Synthesis |
| Chemical Properties | white to off-white adhering crystalline powder | | Uses | L-Alanine Ethyl Ester Hydrochloride is used in the synthesis of nucleoside phosphoramidates as antiviral agents for human immunodeficiency and hepatitis B viruses. Also used in synthesis of enantiomerically pure amino acid ester isocyanates. | | reaction suitability | reaction type: solution phase peptide synthesis | | Synthesis | L-alanine (3.56 g, 0.04 mol) was dissolved in ethanol (30 mL) at -5 °C and thionyl chloride (3.6 mL) was added slowly and dropwise, keeping stirring. Subsequently, the reaction mixture was warmed up to 78 °C and the reaction was refluxed in ethanol for 1.5 hours. Upon completion of the reaction, the solvent was removed by vacuum distillation to afford L-alanine ethyl ester hydrochloride (2a) in over 80% yield. The physical constants of the product 2a were in agreement with the data reported in literature [24]. | | References | [1] Chemical Communications, 2011, vol. 47, # 26, p. 7347 - 7349 [2] Dalton Transactions, 2015, vol. 44, # 3, p. 1170 - 1177 [3] Tetrahedron, 1999, vol. 55, # 11, p. 3337 - 3354 [4] Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2006, vol. 45, # 8, p. 1942 - 1944 [5] Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1994, # 7, p. 1455 - 1462 |
| | Ethyl L-alaninate hydrochloride Preparation Products And Raw materials |
|