| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Fmoc-D-Bip-OH manufacturers
|
| | Fmoc-D-Bip-OH Basic information |
| | Fmoc-D-Bip-OH Chemical Properties |
| Melting point | 179-182° | | Boiling point | 700.7±60.0 °C(Predicted) | | density | 1.257±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.77±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChIKey | VSGACONKQRJFGX-NPFCIKOQNA-N | | SMILES | C12C=CC=CC=1C1=C(C=CC=C1)C2COC(=O)N[C@@H](C(=O)O)CC1=CC=C(C2=CC=CC=C2)C=C1 |&1:18,r| | | CAS DataBase Reference | 205526-38-1(CAS DataBase Reference) |
| | Fmoc-D-Bip-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-d-4,4''-biphenylalanine |
| | Fmoc-D-Bip-OH Preparation Products And Raw materials |
|