|
|
| | Fmoc-9-Amino-4,7-Dioxanonanoic acid Basic information |
| Product Name: | Fmoc-9-Amino-4,7-Dioxanonanoic acid | | Synonyms: | 9-[(9H-Fluoren-9-ylmethoxy)carbonylamino]-4,7-dioxanonanoic Acid;Fmoc-N-amido-PEG2-acid;Fmoc-PEG2- CH2CH2COOH;Fmoc-PEG2-propionic acid;Fmoc-AEEP-OH≥ 98% (HPLC);Fmoc-AEEP;3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoic acid;FMoc-NH-PEG2-CH2CH2COOH | | CAS: | 872679-70-4 | | MF: | C22H25NO6 | | MW: | 399.44 | | EINECS: | | | Product Categories: | peg | | Mol File: | 872679-70-4.mol |  |
| | Fmoc-9-Amino-4,7-Dioxanonanoic acid Chemical Properties |
| Melting point | 95.0 to 99.0 °C | | Boiling point | 621.0±50.0 °C(Predicted) | | density | 1.243±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 4.28±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C22H25NO6/c24-21(25)9-11-27-13-14-28-12-10-23-22(26)29-15-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,20H,9-15H2,(H,23,26)(H,24,25) | | InChIKey | QWHLFJJLRVOHTM-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOCCOCCNC(=O)OCC1C2=C(C=CC=C2)C2=C1C=CC=C2 |
| | Fmoc-9-Amino-4,7-Dioxanonanoic acid Usage And Synthesis |
| Description | Fmoc-N-amido-PEG2-acid is a PEG linker containing an Fmoc-protected amine and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Chemical Properties | White crystalline powder | | Uses | Fmoc-AEEP-OH is used in preparation of glucose-responsive insulin conjugates. | | IC 50 | Cleavable Linker; PEGs |
| | Fmoc-9-Amino-4,7-Dioxanonanoic acid Preparation Products And Raw materials |
|