p-Nitrophenyl beta-D-lactopyranoside manufacturers
|
| | p-Nitrophenyl beta-D-lactopyranoside Basic information |
| | p-Nitrophenyl beta-D-lactopyranoside Chemical Properties |
| Melting point | 263-265°C | | Boiling point | 795.6±60.0 °C(Predicted) | | density | 1.70±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Water (Slightly, Heated) | | pka | 12.43±0.70(Predicted) | | form | powder | | color | white | | Water Solubility | water: 19.60-20.40mg/mL, clear to slightly hazy, colorless to yellow | | InChI | 1S/C18H25NO13/c20-5-9-11(22)12(23)14(25)18(30-9)32-16-10(6-21)31-17(15(26)13(16)24)29-8-3-1-7(2-4-8)19(27)28/h1-4,9-18,20-26H,5-6H2 | | InChIKey | IAYJZWFYUSNIPN-MUKCROHVSA-N | | SMILES | OCC1OC(OC2C(O)C(O)C(OC2CO)Oc3ccc(cc3)N(=O)=O)C(O)C(O)C1O |
| Hazard Codes | T | | Risk Statements | 61 | | Safety Statements | 53-45 | | WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B |
| | p-Nitrophenyl beta-D-lactopyranoside Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | p-Nitrophenyl β-D-Lactopyranoside is a useful compound | | Uses | 4-Nitrophenyl β-D-lactopyranoside may be used as a substrate for determining β-lactosidase activity and for determining the substrate specificity for β-glucosidase from the yeast Debaryomyces hansenii. It has also been used as a substrate for cellobiohydrolase. | | Definition | ChEBI: 4-nitrophenyl beta-lactoside is a disaccharide derivative that is beta-lactose in which the anomeric hydroxy hydrogen is replaced by a 4-nitrophenyl group. It has a role as a chromogenic compound. It is a glycoside, a C-nitro compound and a disaccharide derivative. It is functionally related to a beta-lactose and a 4-nitrophenol. |
| | p-Nitrophenyl beta-D-lactopyranoside Preparation Products And Raw materials |
|