| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Bromo-2,3,4,5-tetrafluorobenzene Basic information | | Uses |
| Product Name: | 1-Bromo-2,3,4,5-tetrafluorobenzene | | Synonyms: | Benzene,1-bromo-2,3,4,5-tetrafluoro-;1-Bromo-2,3,4,5-tetrafluorobenzene 98%;1-Bromo-2,3,4,5-tetrafluorobenzene98%;2,3,4,5-TETRAFLUORO BROMOBENZENE;1-BROMO-2,3,4,5-TETR;2,3,4,5-tetrafluoroethane broMophenyl;1-Bromo-2,3,4,5-tetrafluorobenzene, 1-Bromo-2H-tetrafluorobenzene;2-Bromo-1H-tetrafluorobenzene 98% | | CAS: | 1074-91-5 | | MF: | C6HBrF4 | | MW: | 228.97 | | EINECS: | 214-048-7 | | Product Categories: | Aryl;Halogenated Hydrocarbons;C6 | | Mol File: | 1074-91-5.mol |  |
| | 1-Bromo-2,3,4,5-tetrafluorobenzene Chemical Properties |
| Melting point | 149-150 °C | | Boiling point | 48-55°C 25mm | | density | 1.846 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.466(lit.) | | Fp | 130 °F | | storage temp. | 2-8°C | | form | liquid | | color | Clear | | Specific Gravity | 1.846 | | InChI | InChI=1S/C6HBrF4/c7-2-1-3(8)5(10)6(11)4(2)9/h1H | | InChIKey | BUYSIDPAOVWMQX-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(F)=C(F)C(F)=C1F | | CAS DataBase Reference | 1074-91-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36/37/39 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 2903998090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | 1-Bromo-2,3,4,5-tetrafluorobenzene Usage And Synthesis |
| Uses | 1-Bromo-2,3,4,5-tetrafluorobenzene is a useful research chemical for organic synthesis. | | Chemical Properties | Flash point 54°C, refractive index 1.4660, specific gravity 1.846. | | Uses | 1-Bromo-2,3,4,5-tetrafluorobenzene was used in the synthesis of catalyst Pd(AsPh3)4, required for preparation of cyclometalating ligands 2-(3′,4′,6′-trifluorophenyl)pyridine; n = 4: and 2-(3′,4′,5′,6′-tetrafluorophenyl)pyridine. 1-Bromo-2,3,4,5-tetrafluorobenzene may be used in the synthesis of fluorinated rubrene. |
| | 1-Bromo-2,3,4,5-tetrafluorobenzene Preparation Products And Raw materials |
| Raw materials | 2-Bromo-3,4,5,6-tetrafluorobenzoic acid-->1,2-Dibromotetrafluorobenzene-->1,2,3,4-Tetrafluorobenzene-->2,3,4,5-Tetrafluorobenzoic acid | | Preparation Products | 2,3,4,5-Tetrafluorobenzaldehyde |
|