2,4-Dibromo-6-nitroaniline manufacturers
|
| | 2,4-Dibromo-6-nitroaniline Basic information |
| Product Name: | 2,4-Dibromo-6-nitroaniline | | Synonyms: | 2,4-Dibromo-6-nitroaniline,98%;2,4-DIBROMO-6-NITROANILINE;2,4-Dibromo-6-nitroaniline>;Benzenamine, 2,4-dibromo-6-nitro-;2,4-Dibromo-6-nitroaniline ISO 9001：2015 REACH;2,4-Dibromo-6-nitroaniline 99% | | CAS: | 827-23-6 | | MF: | C6H4Br2N2O2 | | MW: | 295.92 | | EINECS: | 623-304-0 | | Product Categories: | Amines;C2 to C6;Nitrogen Compounds;Anilines, Aromatic Amines and Nitro Compounds | | Mol File: | 827-23-6.mol |  |
| | 2,4-Dibromo-6-nitroaniline Chemical Properties |
| Melting point | 128-130 °C (lit.) | | Boiling point | 207°C (rough estimate) | | density | 2.2265 (rough estimate) | | refractive index | 1.6220 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Powder | | pka | -3.25±0.25(Predicted) | | color | Orange-yellow | | BRN | 2805574 | | InChI | 1S/C6H4Br2N2O2/c7-3-1-4(8)6(9)5(2-3)10(11)12/h1-2H,9H2 | | InChIKey | OBTUHOVIVLDLLD-UHFFFAOYSA-N | | SMILES | Nc1c(Br)cc(Br)cc1[N+]([O-])=O | | CAS DataBase Reference | 827-23-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36-36/37/39 | | WGK Germany | 3 | | HS Code | 29214200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,4-Dibromo-6-nitroaniline Usage And Synthesis |
| Chemical Properties | orange-yellow powder |
| | 2,4-Dibromo-6-nitroaniline Preparation Products And Raw materials |
|