| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2'-Fluoro-4'-hydroxyacetophenone Basic information |
| | 2'-Fluoro-4'-hydroxyacetophenone Chemical Properties |
| Melting point | 120-124 °C | | Boiling point | 203.5°C (rough estimate) | | density | 1.1850 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 7.17±0.18(Predicted) | | form | powder | | color | Cream | | Water Solubility | insoluble | | BRN | 696642 | | InChI | InChI=1S/C8H7FO2/c1-5(10)7-3-2-6(11)4-8(7)9/h2-4,11H,1H3 | | InChIKey | ZCZIRBNZMFUCOH-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(O)C=C1F)C | | CAS DataBase Reference | 98619-07-9(CAS DataBase Reference) |
| | 2'-Fluoro-4'-hydroxyacetophenone Usage And Synthesis |
| Chemical Properties | slightly beige to beige-brown powder | | Uses | 2'-Fluoro-4'-hydroxyacetophenone is used in used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. | | Preparation | Preparation by reaction of acetyl chloride on 3-fluorophenol with aluminium chloride in refluxing ethylene dichloride. |
| | 2'-Fluoro-4'-hydroxyacetophenone Preparation Products And Raw materials |
|