| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- Fmoc-D-Lys(Boc)-OH
-
-
2026-09-17
- CAS:92122-45-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- FMOC-D-Lys(BOC)-OH
-
- $1.00
-
2019-07-06
- CAS:92122-45-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
- FMOC-D-Lys(BOC)-OH
-
- $1.00
-
2019-07-06
- CAS:92122-45-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | FMOC-D-Lys(BOC)-OH Basic information |
| | FMOC-D-Lys(BOC)-OH Chemical Properties |
| Melting point | 135-139°C | | Boiling point | 685.7±55.0 °C(Predicted) | | density | 1.210±0.06 g/cm3(Predicted) | | refractive index | 2.2 ° (C=1, MeOH) | | storage temp. | 2-8°C | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMF (Sparingly) | | form | Solid | | pka | 3.88±0.21(Predicted) | | color | White to Off-White | | Major Application | peptide synthesis | | InChIKey | UMRUUWFGLGNQLI-JOCHJYFZSA-N | | SMILES | C(O)(=O)[C@@H](CCCCNC(OC(C)(C)C)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 92122-45-7(CAS DataBase Reference) |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61-24/25 | | WGK Germany | 3 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | FMOC-D-Lys(BOC)-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Derivative of N6-[(1,1-Dimethylethoxy)carbonyl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-lysine is a hetero-bifunctional traceless linker for temporarily attaching highly solubilizing peptide sequences onto insoluble peptides. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-D-Lys(BOC)-OH Preparation Products And Raw materials |
|