(+)-Biotin-PEG4-Hydrazide manufacturers
- Biotin-PEG4-hydrazide
-
- $0.00 / 100mg
-
2025-06-07
- CAS:756525-97-0
- Min. Order: 100mg
- Purity: >95.00%
- Supply Ability: 100mg
|
| | (+)-Biotin-PEG4-Hydrazide Basic information |
| Product Name: | (+)-Biotin-PEG4-Hydrazide | | Synonyms: | (+)-Biotin-PEG4-Hydrazide;Biotin-dPEG(R)4-hydrazide;Biotin-PEG4-Propinonic hydrazide;4,7,10,13-Tetraoxa-16-azaheneicosanoic acid, 21-[(3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-17-oxo-, hydrazide;Biotin-dPEG??-hydrazide;15-(Biotinamido)-4,7,10,13-tetraoxapentadecanehydrazide;N-[2-[2-[2-[2-(3-Hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]biotinamide;4-hydrazide | | CAS: | 756525-97-0 | | MF: | C21H39N5O7S | | MW: | 505.63 | | EINECS: | | | Product Categories: | | | Mol File: | 756525-97-0.mol |  |
| | (+)-Biotin-PEG4-Hydrazide Chemical Properties |
| Boiling point | 825.5±65.0 °C(Predicted) | | density | 1.201±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 12.82±0.35(Predicted) | | form | solid or viscous liquid | | color | White to Light yellow | | InChIKey | PSBJJOWIACLJAQ-UHFFFAOYSA-N | | SMILES | O=C(CCOCCOCCOCCOCCNC(CCCCC1SCC(C1N2)NC2=O)=O)NN |
| WGK Germany | WGK 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | (+)-Biotin-PEG4-Hydrazide Usage And Synthesis |
| Description | Biotin-PEG4-hydrazide is a biotinylation reagent that can be used to label glycoproteins, carbohydrate-containing compounds that have oxidizable sugars or aldehydes. Hydrazine moiety reacts with an aldehyde to form semi-permanent hydrazone bonds. The hydrophilic PEG arm imparts water solubility that is transferred to the biotinylated molecule. | | Uses | Biotin-PEG4-hydrazide is a biotin-labeled, PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | reaction suitability | reagent type: cross-linking reagent
reaction type: Biotinylations
reactivity: carbonyl reactive | | IC 50 | PEGs | | References | [1] Gadd MS, et al. Structural basis of PROTAC cooperative recognition for selective protein degradation. Nat Chem Biol. 2017 May;13(5):514-521. DOI:10.1038/nchembio.2329 |
| | (+)-Biotin-PEG4-Hydrazide Preparation Products And Raw materials |
|