- 2-Phenyl-1H-benzo[d]imidazole
-
- $50.00
-
2026-08-25
- CAS:716-79-0
- Min. Order: 1kg
- Purity: 99%,Electronic grade(Single metal impurity≤ 100ppb) or pharmaceutical grade
- Supply Ability: 100kg
- 2-Phenylbenzimidazole
-
- $10.00
-
2025-06-20
- CAS:716-79-0
- Min. Order: 1Kg/Bag
- Purity: 99%, 99.5% HPLC
- Supply Ability: 500kg/month
|
| | 2-Phenylbenzimidazole Basic information |
| | 2-Phenylbenzimidazole Chemical Properties |
| Melting point | 293-296 °C (lit.) | | Boiling point | 320.68°C (rough estimate) | | density | 1.1579 (rough estimate) | | refractive index | 1.5014 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 5.23(at 25℃) | | color | Needles from water or plates from alc | | Water Solubility | Slightly soluble in water. | | Merck | 14,7274 | | BRN | 7087 | | InChI | InChI=1S/C13H10N2/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h1-9H,(H,14,15) | | InChIKey | DWYHDSLIWMUSOO-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)NC2=CC=CC=C2N=1 | | CAS DataBase Reference | 716-79-0(CAS DataBase Reference) | | EPA Substance Registry System | 2-Phenylbenzimidazole (716-79-0) |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41-36/37/38 | | Safety Statements | 26-39 | | WGK Germany | 3 | | RTECS | DE0360000 | | TSCA | TSCA listed | | HS Code | 29332900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 | | Toxicity | LD50 ipr-mus: 167 mg/kg FRPSAX 33,516,78 |
| | 2-Phenylbenzimidazole Usage And Synthesis |
| Chemical Properties | white to beige-grey powder and/or chunks | | Uses | 2-Phenylbenzimidazole is used as pharmaceutical intermediate. | | Synthesis Reference(s) | Canadian Journal of Chemistry, 60, p. 1122, 1982 DOI: 10.1139/v82-167 Journal of the American Chemical Society, 79, p. 427, 1957 DOI: 10.1021/ja01559a053 | | Safety Profile | Poison by intraperitoneal route. When heated to decomposition it emits toxic fumes of NOx. |
| | 2-Phenylbenzimidazole Preparation Products And Raw materials |
|