| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Manganese bis(2-ethylhexanoate) Basic information |
| Product Name: | Manganese bis(2-ethylhexanoate) | | Synonyms: | manganese bis(2-ethylhexanoate);MANGANESE (II) 2-ETHYLHEXANOATE;Manganese(II) 2-Ethylhexanoate Mineral Spirit Solution (Mn : 8%);2-ethyl-hexanoicacimanganese(2++)salt;Hexanoicacid,2-ethyl-,manganese(2+)salt;Manganese(II) 2-ethylhexanoate solution;MANGANESE (II) 2-ETHYLHEXANOATE, 40% SOLUTION IN MINERAL SPIRITS (6% MN);40%w/winmineralspirits | | CAS: | 13434-24-7 | | MF: | C16H30MnO4 | | MW: | 341.35 | | EINECS: | 236-562-0 | | Product Categories: | metal carboxylate;Organic-metal salt | | Mol File: | 13434-24-7.mol |  |
| | Manganese bis(2-ethylhexanoate) Chemical Properties |
| density | 0.897 | | Fp | 40°(104°F) | | form | liquid | | Specific Gravity | 0.897 | | color | dark | | Water Solubility | Soluble in organic solvents. Not miscible or difficult to mix with water. | | Exposure limits | ACGIH: TWA 100 ppm OSHA: TWA 500 ppm(2900 mg/m3) NIOSH: IDLH 20000 mg/m3; TWA 350 mg/m3; Ceiling 1800 mg/m3 | | InChI | InChI=1S/2C8H16O2.Mn/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 | | InChIKey | FHRAKXJVEOBCBQ-UHFFFAOYSA-L | | SMILES | C(CC)(CCCC)C(=O)O[Mn]OC(=O)C(CC)CCCC | | EPA Substance Registry System | Hexanoic acid, 2-ethyl-, manganese(2+) salt (13434-24-7) |
| Risk Statements | 10-36/37/38 | | Safety Statements | 16-36/37/39 | | RIDADR | 1993 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III |
| Provider | Language |
|
ALFA
| English |
| | Manganese bis(2-ethylhexanoate) Usage And Synthesis |
| Chemical Properties | Light brown viscous liquid, insoluble in water, slightly soluble in ethanol, soluble in benzene, toluene and turpentine. | | Uses | Used as paint driers. Accelerating curing agent for unsaturated polyester. Also used as a intermediate for dyestuff, pharmaceutical, syntheses material. |
| | Manganese bis(2-ethylhexanoate) Preparation Products And Raw materials |
|