|
|
| | BOC-L-4-Trifluoromethylphe Basic information |
| | BOC-L-4-Trifluoromethylphe Chemical Properties |
| Melting point | 118-137°C | | Boiling point | 431.4±45.0 °C(Predicted) | | density | 1.271±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.76±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D +5.4±0.7°, c = 1% in methanol | | BRN | 5617499 | | Major Application | peptide synthesis | | InChI | 1S/C15H18F3NO4/c1-14(2,3)23-13(22)19-11(12(20)21)8-9-4-6-10(7-5-9)15(16,17)18/h4-7,11H,8H2,1-3H3,(H,19,22)(H,20,21)/t11-/m0/s1 | | InChIKey | SMVCCWNHCHCWAZ-NSHDSACASA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(cc1)C(F)(F)F)C(O)=O | | CAS DataBase Reference | 114873-07-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Harmful/Irritant/Keep Cold | | HS Code | 2924297099 | | Storage Class | 13 - Non Combustible Solids |
| | BOC-L-4-Trifluoromethylphe Usage And Synthesis |
| Uses | N-(tert-Butoxycarbonyl)-4-trifluoromethyl-L-phenylalanine is a useful pharmaceutical intermediate. It is used in the preparation of ring substituted phenylalanines and tryptophans. Also Used in the preparation of proline derivatives with inhibitory action against dipeptidyl peptidase IV. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-L-4-Trifluoromethylphe Preparation Products And Raw materials |
|