|
|
| | FMOC-LEU-OPFP Basic information |
| | FMOC-LEU-OPFP Chemical Properties |
| Melting point | 101-115°C | | Boiling point | 596.3±50.0 °C(Predicted) | | density | 1.350±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 10.32±0.46(Predicted) | | color | White | | BRN | 4731726 | | Major Application | peptide synthesis | | InChIKey | NTQJCLLWLHKJLU-IBGZPJMESA-N | | SMILES | C(OC1=C(F)C(F)=C(F)C(F)=C1F)(=O)[C@H](CC(C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | FMOC-LEU-OPFP Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-LEU-OPFP Preparation Products And Raw materials |
|