- Fmoc-D-Homophe-OH
-
- $0.00/ kg
-
2026-02-02
- CAS:135944-09-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | FMOC-D-HOMOPHENYLALANINE Basic information |
| | FMOC-D-HOMOPHENYLALANINE Chemical Properties |
| Boiling point | 628.3±50.0 °C(Predicted) | | density | 1.254±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.84±0.10(Predicted) | | form | Powder | | color | White | | Optical Rotation | Consistent with structure | | BRN | 4847668 | | Major Application | peptide synthesis | | InChI | 1S/C25H23NO4/c27-24(28)23(15-14-17-8-2-1-3-9-17)26-25(29)30-16-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h1-13,22-23H,14-16H2,(H,26,29)(H,27,28)/t23-/m1/s1 | | InChIKey | CIHPCIUGLIZADU-HSZRJFAPSA-N | | SMILES | OC(=O)[C@@H](CCc1ccccc1)NC(=O)OCC2c3ccccc3-c4ccccc24 | | CAS DataBase Reference | 135944-09-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 13 - Non Combustible Solids |
| | FMOC-D-HOMOPHENYLALANINE Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-D-HOMOPHENYLALANINE Preparation Products And Raw materials |
|