|
|
| | (S)-N-Fmoc-1-Naphthylalanine Basic information |
| | (S)-N-Fmoc-1-Naphthylalanine Chemical Properties |
| Melting point | 171-183℃ | | Boiling point | 549.64°C (rough estimate) | | density | 1.2227 (rough estimate) | | refractive index | 1.6290 (estimate) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.77±0.30(Predicted) | | color | White to off-white | | BRN | 4829118 | | Major Application | peptide synthesis | | InChIKey | ORWNVJDLEMVDLV-SANMLTNESA-N | | SMILES | OC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCC3c4ccccc4-c5ccccc35 | | CAS DataBase Reference | 96402-49-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | (S)-N-Fmoc-1-Naphthylalanine Usage And Synthesis |
| Chemical Properties | white to beige powder | | Uses | Fmoc-1-Nal-OH, is an amino acid derivative used in chemical synthesis and peptide chemistry. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | (S)-N-Fmoc-1-Naphthylalanine Preparation Products And Raw materials |
|