| Company Name: |
ChemeGen(Shanghai) Biotechnology Co.,Ltd.
|
| Tel: |
18818260767 |
| Email: |
sales@chemegen.com |
| Products Intro: |
Product Name:11β-Prostaglandin F2α CAS:38432-87-0 Purity:98% Package:10 mg;50 mg;100 mg;500 mg;1 g;5 g;10 g
|
11BETA-PROSTAGL AND IN F2ALPHA manufacturers
|
| | 11BETA-PROSTAGL AND IN F2ALPHA Basic information |
| Product Name: | 11BETA-PROSTAGL AND IN F2ALPHA | | Synonyms: | 11BETA-PROSTAGL AND IN F2ALPHA;9ALPHA, 11BETA, 15S-TRIHYDROXY-PROSTA-5Z, 13E-DIEN-1-OIC ACID;9ALPHA,11BETA-PGF2;9ALPHA,11BETA-PROSTAGLANDIN F2;11betaPGF2alpha;11BETA-PROSTAGLANDIN F2ALPHA 99+%;11β-Prostaglandin F2α Lipid Maps MS Standard;9α,11β-PGF2 (9α,11β-Prostaglandin F2) | | CAS: | 38432-87-0 | | MF: | C20H34O5 | | MW: | 354.49 | | EINECS: | | | Product Categories: | | | Mol File: | 38432-87-0.mol |  |
| | 11BETA-PROSTAGL AND IN F2ALPHA Chemical Properties |
| Boiling point | 531.0±50.0 °C(Predicted) | | density | 1.153±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMF: 100 mg/ml,DMSO: 100 mg/ml,Ethanol: 100 mg/ml,PBS pH 7.2: 10 mg/ml | | pka | 4.76±0.10(Predicted) | | form | powder | | InChIKey | PXGPLTODNUVGFL-ZWAKLXPCSA-N | | SMILES | O[C@H]1C[C@H](O)[C@H](C/C=C\CCCC(O)=O)[C@H]1/C=C/[C@@H](O)CCCCC |
| WGK Germany | WGK 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Repr. 1B |
| | 11BETA-PROSTAGL AND IN F2ALPHA Usage And Synthesis |
| Uses | 9alpha,11beta-PGF2 (9alpha,11beta-Prostaglandin F2) is platelet aggregation and adipose differentiation inhibitor. | | Definition | ChEBI: 11-epi-prostaglandin F2alpha is the prostaglandin F that is the 11-epimer of prostaglandin F2alpha. It has a role as a human metabolite. It is functionally related to a prostaglandin F2alpha. It is a conjugate acid of an 11-epi-prostaglandin F2alpha(1-). |
| | 11BETA-PROSTAGL AND IN F2ALPHA Preparation Products And Raw materials |
|