- D-1-Naphthylalanine
-
- $1.00
-
2019-07-06
- CAS:78306-92-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 100KG
|
| | D-1-Naphthylalanine Basic information |
| | D-1-Naphthylalanine Chemical Properties |
| Boiling point | 412.3±33.0 °C(Predicted) | | density | 1.254±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | 2 M HCl: 50 mg/mL, clear, yellow | | form | Solid | | pka | 2.21±0.30(Predicted) | | Appearance | Off-white to light yellow Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C13H13NO2/c14-12(13(15)16)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7,12H,8,14H2,(H,15,16)/t12-/s3 | | InChIKey | OFYAYGJCPXRNBL-PLAQIDKDNA-N | | SMILES | C12C=CC=CC=1C=CC=C2C[C@@H](N)C(=O)O |&1:11,r| | | CAS DataBase Reference | 78306-92-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2922498590 |
| | D-1-Naphthylalanine Usage And Synthesis |
| Uses | 3-(1-Naphthyl)-D-alanine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. |
| | D-1-Naphthylalanine Preparation Products And Raw materials |
|