|
|
| | 2,3-Difluorobenzaldehyde Basic information |
| Product Name: | 2,3-Difluorobenzaldehyde | | Synonyms: | 2,3-DIFLUOROBENZALDEHYDE;TIMTEC-BB SBB006572;2,3-Difluorobenzaldehyde,98%;2,3-Difluorobenzaldehyde 98%;2,5-DIFLUOROBENALDEHYDE;2,3-fluorobenzaldehyde;2,3- twofluorobenzeneforMaldehyde;Benzaldehyde, 2,3-difluoro- | | CAS: | 2646-91-5 | | MF: | C7H4F2O | | MW: | 142.1 | | EINECS: | 607-944-8 | | Product Categories: | Aldehydes;C7;Carbonyl Compounds;Fluorobenzene;Carbonyl Compounds;Aromatic Aldehydes & Derivatives (substituted);Aromatic compound;Fluorin-contained benzaldehyde series;Benzaldehyde;Miscellaneous | | Mol File: | 2646-91-5.mol |  |
| | 2,3-Difluorobenzaldehyde Chemical Properties |
| Melting point | 64-65 °C | | Boiling point | 64-65 °C/17 mmHg (lit.) | | density | 1.301 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.499(lit.) | | Fp | 137 °F | | storage temp. | Inert atmosphere,2-8°C | | form | Liquid | | Specific Gravity | 1.301 | | color | Clear pale yellow | | Sensitive | Air Sensitive | | BRN | 2961554 | | InChI | InChI=1S/C7H4F2O/c8-6-3-1-2-5(4-10)7(6)9/h1-4H | | InChIKey | WDBAXYQUOZDFOJ-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=CC(F)=C1F | | CAS DataBase Reference | 2646-91-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36/37 | | RIDADR | UN 1989 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29130000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | 2,3-Difluorobenzaldehyde Usage And Synthesis |
| Chemical Properties | clear pale yellow liquid | | Uses | 2,3-Difluorobenzaldehyde was used in the synthesis of aminophosphine. | | General Description | The emission and absorption spectra of 2,3-difluorobenzaldehyde were studied. | | Synthesis | The general steps for the synthesis of 2,3-difluorobenzaldehyde from 2,3-difluorotoluene are as follows: (1) Preparation of the device: connect the tubular reactor as shown in Fig. 2, and choose a combination of pipes with (3a + 3c) DC channels and inclined square pancake-type variable diameter flat pipes. Determine the pipe diameter and volume according to the experimental needs. (2) Solution preparation: 6.06 g of cobalt acetate and 6.06 g of sodium molybdate were dissolved in 200 mL of acetic acid containing 200 mg of 2,3-difluorotoluene to form a mixed solution, ensuring that n (cobalt acetate): n (2,3-difluorotoluene) = 0.015:1. Meanwhile, 6.06 g of sodium bromide was dissolved in 35% H2O2 to prepare a H2O2-acetic acid solution, adjusting n (sodium bromide): n(2,3-difluorotoluene) = 0.015: 1. (3) Reaction process: 2,3-difluorotoluene-acetic acid solution and H2O2-acetic acid solution were injected into a continuous heat exchanger tubular reactor through a constant-flow pump at a flow rate of 5.56 ml/min and 11.11 ml/min, respectively, to ensure that n(H2O2): n(2,3-difluorotoluene) = 2:1. The reaction was carried out in a microchannel reactor with a set reaction temperature of 120 °C and a residence time of 1500 s. (4) Post-treatment: after completion of the reaction, the outlet material was cooled and the reaction was quenched with dichloromethane. The conversion of 2,3-difluorotoluene was determined to be 65.1% and the yield of 2,3-difluorobenzaldehyde was 48.2% by GC analysis. | | References | [1] Patent: CN106748682, 2017, A. Location in patent: Paragraph 0052-0054
[2] Kogyo Kagaku Zasshi, 1956, vol. 59, p. 1160
[3] Chem.Abstr., 1958, p. 13265 |
| | 2,3-Difluorobenzaldehyde Preparation Products And Raw materials |
|