|
|
| | (R)-N-Boc-(4-Pyridyl)alanine Basic information |
| | (R)-N-Boc-(4-Pyridyl)alanine Chemical Properties |
| Melting point | 223-229 °C | | Boiling point | 409.5°C (rough estimate) | | density | 1.1738 (rough estimate) | | refractive index | 1.6450 (estimate) | | storage temp. | Inert atmosphere,2-8°C | | form | Powder | | pka | 3.43±0.10(Predicted) | | color | White | | Optical Rotation | [α]20/D +4.1±0.5°, c = 0.6% in acetic acid | | Sensitive | Air & Moisture Sensitive | | BRN | 4195478 | | Major Application | peptide synthesis | | InChI | 1S/C13H18N2O4/c1-13(2,3)19-12(18)15-10(11(16)17)8-9-4-6-14-7-5-9/h4-7,10H,8H2,1-3H3,(H,15,18)(H,16,17)/t10-/m1/s1 | | InChIKey | FNYWDMKESUACOU-SNVBAGLBSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccncc1)C(O)=O | | CAS DataBase Reference | 37535-58-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29223900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-N-Boc-(4-Pyridyl)alanine Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | (R)-N-Boc-(4-Pyridyl)alanine Preparation Products And Raw materials |
|