- BOC-LYS(Z)-OH DCHA
-
- $2.00 / 1KG
-
2020-01-08
- CAS:16948-04-2
- Min. Order: 1g
- Purity: 98%MIN
- Supply Ability: ASK
|
| | BOC-LYS(Z)-OH DCHA Basic information |
| Product Name: | BOC-LYS(Z)-OH DCHA | | Synonyms: | N-ALPHA-T-BUTOXYCARBONYL-N-EPSILON-CARBOBENZOXY-L-LYSINE DICYCLOHEXYLAMMONIUM SALT;(2S)-2-[[(2-methylpropan-2-yl)oxy-oxomethyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate;N-alpha-Boc-Nepsilon-Z-L-lysine dicyclohexylammonium salt;NALPHA-T-BOC-NEPSILON-CARBOBENZOXY-L-LYSINE DICYCLOHEXYLAMINE SALT;N-ALPHA-BOC-N-EPSILON-CBZ-L-LYSINE DICYCLOHEXYLAMMONIUM SALT;N-ALPHA-BOC-N-EPSILON-Z-L-LYSINE DICYCLOHEXYLAMINE SALT;N-EPSILON-Z-N-ALPHA-BOC-L-LYSINE DICYCLOHEXYLAMINE SALT;ALPHA-BOC-EPSILON-CBZ-L-LYSINE DCHA | | CAS: | 16948-04-2 | | MF: | C31H51N3O6 | | MW: | 561.75 | | EINECS: | 241-018-0 | | Product Categories: | | | Mol File: | 16948-04-2.mol |  |
| | BOC-LYS(Z)-OH DCHA Chemical Properties |
| Melting point | 114-116 °C | | storage temp. | Inert atmosphere,2-8°C | | form | solid | | Optical Rotation | [α]20/D 5.2±0.5°, c = 1% in acetic acid | | BRN | 4121117 | | Major Application | peptide synthesis | | InChIKey | BQERJWRZLXZNIO-RSAXXLAASA-N | | SMILES | C1CCC(CC1)NC2CCCCC2.CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCc3ccccc3)C(O)=O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29224985 | | Storage Class | 11 - Combustible Solids |
| | BOC-LYS(Z)-OH DCHA Usage And Synthesis |
| Chemical Properties | WHITE FINE CRYSTALLINE POWDER | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-LYS(Z)-OH DCHA Preparation Products And Raw materials |
|