|
|
| | 1,2,3-Trifluorobenzene Basic information |
| Product Name: | 1,2,3-Trifluorobenzene | | Synonyms: | 1,2,3-TRIFLUOROBENZENE;1,2,3-Trifluorobenzene, 98+%;3-chloro-4-flurobenzonitrile;1,2,3-Trifluorobenzene 99%;1,2,3-Trifluorobenzene99%;1,2,3-Trifluorobenze;1,2,3-fluorobenzene;1,2,3-Trifluorobenzene, 99% 1GR | | CAS: | 1489-53-8 | | MF: | C6H3F3 | | MW: | 132.08 | | EINECS: | | | Product Categories: | Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Industrial/Fine Chemicals;Fluorobenzene;Miscellaneous;Aryl;Halogenated Hydrocarbons;C6 | | Mol File: | 1489-53-8.mol |  |
| | 1,2,3-Trifluorobenzene Chemical Properties |
| Boiling point | 94-95 °C (lit.) | | density | 1.28 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.423(lit.) | | Fp | 25 °F | | storage temp. | Flammables area | | form | clear liquid | | Specific Gravity | 1.280 | | color | Colorless to Light orange to Yellow | | BRN | 1862388 | | Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C6H3F3/c7-4-2-1-3-5(8)6(4)9/h1-3H | | InChIKey | AJKNNUJQFALRIK-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC(F)=C1F | | CAS DataBase Reference | 1489-53-8(CAS DataBase Reference) |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-36/37/39-37/39-33-7/9 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,2,3-Trifluorobenzene Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | 1,2, 3-trifluorobenzene is an organic fluorine compound, mainly used as an intermediate in the production of drugs, agricultural chemicals and dyes. | | General Description | Crystal structure 1,2,3-trifluorobenzene was reported. The microwave spectrum of 1,2,3-trifluorobenzene was studied using a molecular beam Fourier transform microwave spectrometer. Laser-induced fluorescence spectra of the radical cation of 1,2,3-trifluorobenzene was determined in both the gas phase and solid Ne matrices. |
| | 1,2,3-Trifluorobenzene Preparation Products And Raw materials |
| Raw materials | Benzene, 1,2,3-trichloro-4,5,6-trifluoro--->Benzene, 1,2,4-trichloro-3,5,6-trifluoro--->1,2,4-Trifluorobenzene-->1,3,5-Trifluorobenzene-->2,3-Dichlorofluorobenzene-->2,3-DIFLUOROCHLOROBENZENE-->2-Chloro-1,3-difluorobenzene-->1,3-Dichloro-2-fluorobenzene-->1,2,3-Trichlorobenzene | | Preparation Products | 2,6-Difluorophenylacetic acid-->2,3,4-Trifluorobromobenzene-->2,3-Difluorophenol-->1-Iodo-2,3,4-trifluorobenzene |
|