| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
- N3-PEG3-NHS
-
-
2026-07-24
- CAS:1245718-89-1
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
|
| | Azido-PEG3-NHS ester Basic information |
| Product Name: | Azido-PEG3-NHS ester | | Synonyms: | N3-PEG3-C2-NHS ester;Azido-PEG3-NHS ester;N3-PEG3-CH2CH2COONHS Ester;AZIDO-PEG3-NHS;N3-PEG3-CH2CH2COONHS;NHS ester-PEG3-Azide;N3-PEG3-NHS,Azido-PEG3-NHS ester;N3-PEG3-Osu | | CAS: | 1245718-89-1 | | MF: | C13H20N4O7 | | MW: | 344.32 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1245718-89-1.mol |  |
| | Azido-PEG3-NHS ester Chemical Properties |
| storage temp. | Storage temp. -20°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C13H20N4O7/c14-16-15-4-6-22-8-10-23-9-7-21-5-3-13(20)24-17-11(18)1-2-12(17)19/h1-10H2 | | InChIKey | BNLXVOZUEBSSRI-UHFFFAOYSA-N | | SMILES | O(N1C(CCC1=O)=O)C(=O)CCOCCOCCOCCN=[N+]=[N-] |
| | Azido-PEG3-NHS ester Usage And Synthesis |
| Description | Azido-PEG3-NHS ester is a azide linker used on click chemistry. The azide group can react with alkyne such as BCN, DBCO, Propargyl group via Click Chemistry to yield a stable triazole linkage. The NHS ester can be applied to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. | | Uses | N3-PEG3-C2-NHS ester is a nonclaevable 3-unit PEG linker used in the synthesis of antibody-drug conjugates (ADCs). N3-PEG3-C2-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | | IC 50 | Non-cleavable Linker |
| | Azido-PEG3-NHS ester Preparation Products And Raw materials |
|