Cereblon Ligand 1 manufacturers
- Cereblon Ligand 1
-
-
2026-06-30
- CAS:1061605-21-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- Thalidomide-O-COOH
-
-
2025-06-07
- CAS:1061605-21-7
- Min. Order: 10mg
- Purity: >95.00%
- Supply Ability: 10g
|
| | Cereblon Ligand 1 Basic information |
| Product Name: | Cereblon Ligand 1 | | Synonyms: | Cereblon Ligand 1;2-[[2-(2,6-Dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]oxy]acetic acid;TC E3 5031;Thalidomide-O-COOH;Cereblon ligand 3;Pomalidomide Related Compound 1;Thalidomide-Acid;Acetic acid, 2-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]oxy]- | | CAS: | 1061605-21-7 | | MF: | C15H12N2O7 | | MW: | 332.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1061605-21-7.mol |  |
| | Cereblon Ligand 1 Chemical Properties |
| Boiling point | 660.5±55.0 °C(Predicted) | | density | 1.606±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in DCM | | form | A crystalline solid | | pka | 2.95±0.10(Predicted) | | color | White to off-white | | Appearance | beige powder | | InChI | InChI=1S/C15H12N2O7/c18-10-5-4-8(13(21)16-10)17-14(22)7-2-1-3-9(12(7)15(17)23)24-6-11(19)20/h1-3,8H,4-6H2,(H,19,20)(H,16,18,21) | | InChIKey | ZVWIXIGBWIEDFO-UHFFFAOYSA-N | | SMILES | C(O)(=O)COC1=CC=CC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| WGK Germany | WGK 3 | | HS Code | 2933998090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Repr. 1A |
| | Cereblon Ligand 1 Usage And Synthesis |
| Description |
Thalidomide-Acid (Cereblon Ligand 1) is a linker of Thalidomide which is commonly used as a precursor to PROTAC that hijacks cereblon as the E3 ubiquitin ligase component.
| | Uses | Thalidomide-4-hydroxyacetate (Cereblon Ligand 1) is a proteolysis targeting chimeras which allows for the optical control of protein degradation. | | IC 50 | Cereblon | | Solubility in organics | DMF: 30 mg/ml
DMSO: 30 mg/ml
PBS (pH 7.2): 1 mg/ml | | storage | Store at RT |
| | Cereblon Ligand 1 Preparation Products And Raw materials |
|